C23H18BrNO2S — CID 139187424
3-(4-bromophenyl)-2-ethenyl-1-(4-methylphenyl)sulfonylindole (PubChem CID 139187424) has the molecular formula C23H18BrNO2S and a molecular weight of 452.37 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-ethenyl-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 3-(4-bromophenyl)-2-ethenyl-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 139187424 |
| Molecular Formula | C23H18BrNO2S |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 3-(4-bromophenyl)-2-ethenyl-1-(4-methylphenyl)sulfonylindole |
| SMILES | C=Cc1c(-c2ccc(Br)cc2)c2ccccc2n1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H18BrNO2S/c1-3-21-23(17-10-12-18(24)13-11-17)20-6-4-5-7-22(20)25(21)28(26,27)19-14-8-16(2)9-15-19/h3-15H,1H2,2H3 |
| InChIKey | ULMKEMNVSZFJKA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |