C20H30O2 — CID 139176180
(2R)-2-[(S)-hydroxy-(4-methylphenyl)methyl]cyclododecan-1-one (PubChem CID 139176180) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (2R)-2-[(S)-hydroxy-(4-methylphenyl)methyl]cyclododecan-1-one.
| Compound Name | (2R)-2-[(S)-hydroxy-(4-methylphenyl)methyl]cyclododecan-1-one |
|---|---|
| PubChem CID | 139176180 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (2R)-2-[(S)-hydroxy-(4-methylphenyl)methyl]cyclododecan-1-one |
| SMILES | Cc1ccc([C@@H](O)[C@H]2CCCCCCCCCCC2=O)cc1 |
| InChI | InChI=1S/C20H30O2/c1-16-12-14-17(15-13-16)20(22)18-10-8-6-4-2-3-5-7-9-11-19(18)21/h12-15,18,20,22H,2-11H2,1H3/t18-,20+/m0/s1 |
| InChIKey | WDBKJLWQXZXKLE-AZUAARDMSA-N |
| XLogP | 5.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |