About (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one
(2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one (PubChem CID 53348860) has the molecular formula C17H18F6O2
and a molecular weight of 368.32 g/mol. Its IUPAC name is (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one.
Molecular Properties
| Compound Name | (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one |
| PubChem CID | 53348860 |
| Molecular Formula | C17H18F6O2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one |
| SMILES | O=C1CCCCCC[C@@H]1[C@@H](O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F6O2/c18-16(19,20)11-7-10(8-12(9-11)17(21,22)23)15(25)13-5-3-1-2-4-6-14(13)24/h7-9,13,15,25H,1-6H2/t13-,15-/m0/s1 |
| InChIKey | DZDQCUCRUVRIBP-ZFWWWQNUSA-N |
| XLogP | 5.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one?
The IUPAC name of (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one (CID 53348860) is (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one.
What is the SMILES notation for (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one?
The canonical SMILES for (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one is O=C1CCCCCC[C@@H]1[C@@H](O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one?
The InChIKey is DZDQCUCRUVRIBP-ZFWWWQNUSA-N. The full InChI is InChI=1S/C17H18F6O2/c18-16(19,20)11-7-10(8-12(9-11)17(21,22)23)15(25)13-5-3-1-2-4-6-14(13)24/h7-9,13,15,25H,1-6H2/t13-,15-/m0/s1.
What are the key properties of (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one?
(2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one has a molecular weight of 368.32 g/mol, XLogP of 5.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]cyclooctan-1-one is sourced from PubChem (CID 53348860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).