C15H16F3NO3 — CID 102267074
(2S)-2-[(1S)-2-nitro-1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexan-1-one (PubChem CID 102267074) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-nitro-1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(1S)-2-nitro-1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102267074 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (2S)-2-[(1S)-2-nitro-1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexan-1-one |
| SMILES | O=C1CCCC[C@H]1[C@H](C[N+](=O)[O-])c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3NO3/c16-15(17,18)11-5-3-4-10(8-11)13(9-19(21)22)12-6-1-2-7-14(12)20/h3-5,8,12-13H,1-2,6-7,9H2/t12-,13+/m0/s1 |
| InChIKey | MNVFKFVUDOJWTE-QWHCGFSZSA-N |
| XLogP | 3.83 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|