C12H15NO3S — CID 100981524
(2S)-2-[(1R)-2-nitro-1-thiophen-2-ylethyl]cyclohexan-1-one (PubChem CID 100981524) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is (2S)-2-[(1R)-2-nitro-1-thiophen-2-ylethyl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(1R)-2-nitro-1-thiophen-2-ylethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 100981524 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (2S)-2-[(1R)-2-nitro-1-thiophen-2-ylethyl]cyclohexan-1-one |
| SMILES | O=C1CCCC[C@H]1[C@H](C[N+](=O)[O-])c1cccs1 |
| InChI | InChI=1S/C12H15NO3S/c14-11-5-2-1-4-9(11)10(8-13(15)16)12-6-3-7-17-12/h3,6-7,9-10H,1-2,4-5,8H2/t9-,10-/m0/s1 |
| InChIKey | IXTLLOSYBIWABX-UWVGGRQHSA-N |
| XLogP | 2.87 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|