C9H12F3NO3 — CID 86324690
(2S)-2-[(2S)-1,1,1-trifluoro-3-nitropropan-2-yl]cyclohexan-1-one (PubChem CID 86324690) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is (2S)-2-[(2S)-1,1,1-trifluoro-3-nitropropan-2-yl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(2S)-1,1,1-trifluoro-3-nitropropan-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 86324690 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (2S)-2-[(2S)-1,1,1-trifluoro-3-nitropropan-2-yl]cyclohexan-1-one |
| SMILES | O=C1CCCC[C@H]1[C@@H](C[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO3/c10-9(11,12)7(5-13(15)16)6-3-1-2-4-8(6)14/h6-7H,1-5H2/t6-,7+/m0/s1 |
| InChIKey | OIKQDKNGGZIECX-NKWVEPMBSA-N |
| XLogP | 2.20 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|