C20H20F3NO — CID 102075036
(2R)-2-[(S)-anilino-[4-(trifluoromethyl)phenyl]methyl]cyclohexan-1-one (PubChem CID 102075036) has the molecular formula C20H20F3NO and a molecular weight of 347.38 g/mol. Its IUPAC name is (2R)-2-[(S)-anilino-[4-(trifluoromethyl)phenyl]methyl]cyclohexan-1-one.
| Compound Name | (2R)-2-[(S)-anilino-[4-(trifluoromethyl)phenyl]methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102075036 |
| Molecular Formula | C20H20F3NO |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (2R)-2-[(S)-anilino-[4-(trifluoromethyl)phenyl]methyl]cyclohexan-1-one |
| SMILES | O=C1CCCC[C@@H]1[C@H](Nc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO/c21-20(22,23)15-12-10-14(11-13-15)19(17-8-4-5-9-18(17)25)24-16-6-2-1-3-7-16/h1-3,6-7,10-13,17,19,24H,4-5,8-9H2/t17-,19+/m0/s1 |
| InChIKey | USHOOBIRWBPDNF-PKOBYXMFSA-N |
| XLogP | 5.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |