C19H20BrNO — CID 141404305
2-[anilino-(2-bromophenyl)methyl]cyclohexan-1-one (PubChem CID 141404305) has the molecular formula C19H20BrNO and a molecular weight of 358.28 g/mol. Its IUPAC name is 2-[anilino-(2-bromophenyl)methyl]cyclohexan-1-one.
| Compound Name | 2-[anilino-(2-bromophenyl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 141404305 |
| Molecular Formula | C19H20BrNO |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-[anilino-(2-bromophenyl)methyl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1C(Nc1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C19H20BrNO/c20-17-12-6-4-10-15(17)19(16-11-5-7-13-18(16)22)21-14-8-2-1-3-9-14/h1-4,6,8-10,12,16,19,21H,5,7,11,13H2 |
| InChIKey | GCDFFAPRMINBOP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |