C25H25NO4 — CID 46837882
2-[(S)-anilino-[(1R)-2-oxocyclohexyl]methyl]-5-phenylmethoxypyran-4-one (PubChem CID 46837882) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[(S)-anilino-[(1R)-2-oxocyclohexyl]methyl]-5-phenylmethoxypyran-4-one.
| Compound Name | 2-[(S)-anilino-[(1R)-2-oxocyclohexyl]methyl]-5-phenylmethoxypyran-4-one |
|---|---|
| PubChem CID | 46837882 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-[(S)-anilino-[(1R)-2-oxocyclohexyl]methyl]-5-phenylmethoxypyran-4-one |
| SMILES | O=C1CCCC[C@@H]1[C@H](Nc1ccccc1)c1cc(=O)c(OCc2ccccc2)co1 |
| InChI | InChI=1S/C25H25NO4/c27-21-14-8-7-13-20(21)25(26-19-11-5-2-6-12-19)23-15-22(28)24(17-30-23)29-16-18-9-3-1-4-10-18/h1-6,9-12,15,17,20,25-26H,7-8,13-14,16H2/t20-,25-/m0/s1 |
| InChIKey | LGIZIYGZOXXESW-CPJSRVTESA-N |
| XLogP | 5.13 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |