C20H23NO — CID 101375640
(2R)-2-[(S)-anilino(phenyl)methyl]cycloheptan-1-one (PubChem CID 101375640) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (2R)-2-[(S)-anilino(phenyl)methyl]cycloheptan-1-one.
| Compound Name | (2R)-2-[(S)-anilino(phenyl)methyl]cycloheptan-1-one |
|---|---|
| PubChem CID | 101375640 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (2R)-2-[(S)-anilino(phenyl)methyl]cycloheptan-1-one |
| SMILES | O=C1CCCCC[C@@H]1[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO/c22-19-15-9-3-8-14-18(19)20(16-10-4-1-5-11-16)21-17-12-6-2-7-13-17/h1-2,4-7,10-13,18,20-21H,3,8-9,14-15H2/t18-,20+/m0/s1 |
| InChIKey | ADKRKVAINLIRKK-AZUAARDMSA-N |
| XLogP | 4.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |