C20H20F3NO2 — CID 102346346
2-[phenyl-[4-(trifluoromethoxy)anilino]methyl]cyclohexan-1-one (PubChem CID 102346346) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 2-[phenyl-[4-(trifluoromethoxy)anilino]methyl]cyclohexan-1-one.
| Compound Name | 2-[phenyl-[4-(trifluoromethoxy)anilino]methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102346346 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-[phenyl-[4-(trifluoromethoxy)anilino]methyl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1C(Nc1ccc(OC(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H20F3NO2/c21-20(22,23)26-16-12-10-15(11-13-16)24-19(14-6-2-1-3-7-14)17-8-4-5-9-18(17)25/h1-3,6-7,10-13,17,19,24H,4-5,8-9H2 |
| InChIKey | KCBXMSZJJPTQOI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|