C18H18INO — CID 7034207
(2R)-2-[(S)-(4-iodoanilino)-phenylmethyl]cyclopentan-1-one (PubChem CID 7034207) has the molecular formula C18H18INO and a molecular weight of 391.25 g/mol. Its IUPAC name is (2R)-2-[(S)-(4-iodoanilino)-phenylmethyl]cyclopentan-1-one.
| Compound Name | (2R)-2-[(S)-(4-iodoanilino)-phenylmethyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 7034207 |
| Molecular Formula | C18H18INO |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | (2R)-2-[(S)-(4-iodoanilino)-phenylmethyl]cyclopentan-1-one |
| SMILES | O=C1CCC[C@@H]1[C@H](Nc1ccc(I)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H18INO/c19-14-9-11-15(12-10-14)20-18(13-5-2-1-3-6-13)16-7-4-8-17(16)21/h1-3,5-6,9-12,16,18,20H,4,7-8H2/t16-,18+/m0/s1 |
| InChIKey | DGQNMZQQSHHYKF-FUHWJXTLSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|