C19H27BrO2 — CID 71483121
(2R)-2-[(S)-(4-bromophenyl)-hydroxymethyl]cyclododecan-1-one (PubChem CID 71483121) has the molecular formula C19H27BrO2 and a molecular weight of 367.33 g/mol. Its IUPAC name is (2R)-2-[(S)-(4-bromophenyl)-hydroxymethyl]cyclododecan-1-one.
| Compound Name | (2R)-2-[(S)-(4-bromophenyl)-hydroxymethyl]cyclododecan-1-one |
|---|---|
| PubChem CID | 71483121 |
| Molecular Formula | C19H27BrO2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2R)-2-[(S)-(4-bromophenyl)-hydroxymethyl]cyclododecan-1-one |
| SMILES | O=C1CCCCCCCCCC[C@@H]1[C@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H27BrO2/c20-16-13-11-15(12-14-16)19(22)17-9-7-5-3-1-2-4-6-8-10-18(17)21/h11-14,17,19,22H,1-10H2/t17-,19+/m0/s1 |
| InChIKey | ZMNWLVJKLSIZNX-PKOBYXMFSA-N |
| XLogP | 5.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |