C15H18O4 — CID 16726034
methyl 4-[(R)-hydroxy-[(1S)-2-oxocyclohexyl]methyl]benzoate (PubChem CID 16726034) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl 4-[(R)-hydroxy-[(1S)-2-oxocyclohexyl]methyl]benzoate.
| Compound Name | methyl 4-[(R)-hydroxy-[(1S)-2-oxocyclohexyl]methyl]benzoate |
|---|---|
| PubChem CID | 16726034 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl 4-[(R)-hydroxy-[(1S)-2-oxocyclohexyl]methyl]benzoate |
| SMILES | COC(=O)c1ccc([C@H](O)[C@@H]2CCCCC2=O)cc1 |
| InChI | InChI=1S/C15H18O4/c1-19-15(18)11-8-6-10(7-9-11)14(17)12-4-2-3-5-13(12)16/h6-9,12,14,17H,2-5H2,1H3/t12-,14+/m1/s1 |
| InChIKey | VMOBZEVCEKUITQ-OCCSQVGLSA-N |
| XLogP | 2.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |