C14H18O3 — CID 132822025
2-[(R)-hydroxy-(2-methoxyphenyl)methyl]cyclohexan-1-one (PubChem CID 132822025) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[(R)-hydroxy-(2-methoxyphenyl)methyl]cyclohexan-1-one.
| Compound Name | 2-[(R)-hydroxy-(2-methoxyphenyl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 132822025 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-[(R)-hydroxy-(2-methoxyphenyl)methyl]cyclohexan-1-one |
| SMILES | COc1ccccc1[C@H](O)C1CCCCC1=O |
| InChI | InChI=1S/C14H18O3/c1-17-13-9-5-3-7-11(13)14(16)10-6-2-4-8-12(10)15/h3,5,7,9-10,14,16H,2,4,6,8H2,1H3/t10?,14-/m1/s1 |
| InChIKey | PSQNPRCJQYSBQM-LNUXAPHWSA-N |
| XLogP | 2.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |