C17H18O2 — CID 101202152
(2S)-2-[(R)-hydroxy(naphthalen-1-yl)methyl]cyclohexan-1-one (PubChem CID 101202152) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S)-2-[(R)-hydroxy(naphthalen-1-yl)methyl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(R)-hydroxy(naphthalen-1-yl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 101202152 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2S)-2-[(R)-hydroxy(naphthalen-1-yl)methyl]cyclohexan-1-one |
| SMILES | O=C1CCCC[C@H]1[C@@H](O)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H18O2/c18-16-11-4-3-9-15(16)17(19)14-10-5-7-12-6-1-2-8-13(12)14/h1-2,5-8,10,15,17,19H,3-4,9,11H2/t15-,17+/m1/s1 |
| InChIKey | TURQJCKHOXVDDK-WBVHZDCISA-N |
| XLogP | 3.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |