C24H28O5 — CID 16681484
diethyl 2-[(S)-naphthalen-1-yl-[(1S)-2-oxocyclohexyl]methyl]propanedioate (PubChem CID 16681484) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is diethyl 2-[(S)-naphthalen-1-yl-[(1S)-2-oxocyclohexyl]methyl]propanedioate.
| Compound Name | diethyl 2-[(S)-naphthalen-1-yl-[(1S)-2-oxocyclohexyl]methyl]propanedioate |
|---|---|
| PubChem CID | 16681484 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | diethyl 2-[(S)-naphthalen-1-yl-[(1S)-2-oxocyclohexyl]methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(c1cccc2ccccc12)[C@@H]1CCCCC1=O |
| InChI | InChI=1S/C24H28O5/c1-3-28-23(26)22(24(27)29-4-2)21(19-13-7-8-15-20(19)25)18-14-9-11-16-10-5-6-12-17(16)18/h5-6,9-12,14,19,21-22H,3-4,7-8,13,15H2,1-2H3/t19-,21?/m1/s1 |
| InChIKey | BYCPIGLXYIAYHU-YMBRHYMPSA-N |
| XLogP | 4.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|