C22H23NO4S — CID 102109922
(2S)-2-[(R)-[1-(benzenesulfonyl)indol-3-yl]-hydroxymethyl]cycloheptan-1-one (PubChem CID 102109922) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is (2S)-2-[(R)-[1-(benzenesulfonyl)indol-3-yl]-hydroxymethyl]cycloheptan-1-one.
| Compound Name | (2S)-2-[(R)-[1-(benzenesulfonyl)indol-3-yl]-hydroxymethyl]cycloheptan-1-one |
|---|---|
| PubChem CID | 102109922 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (2S)-2-[(R)-[1-(benzenesulfonyl)indol-3-yl]-hydroxymethyl]cycloheptan-1-one |
| SMILES | O=C1CCCCC[C@H]1[C@@H](O)c1cn(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C22H23NO4S/c24-21-14-6-2-5-12-18(21)22(25)19-15-23(20-13-8-7-11-17(19)20)28(26,27)16-9-3-1-4-10-16/h1,3-4,7-11,13,15,18,22,25H,2,5-6,12,14H2/t18-,22-/m1/s1 |
| InChIKey | IGXMIJKTYFJORB-XMSQKQJNSA-N |
| XLogP | 4.06 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |