About 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole
1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole (PubChem CID 15711202) has the molecular formula C18H17NO2S3
and a molecular weight of 375.54 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole |
| PubChem CID | 15711202 |
| Molecular Formula | C18H17NO2S3 |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole |
| SMILES | O=S(=O)(c1ccccc1)n1cc(C2SCCCS2)c2ccccc21 |
| InChI | InChI=1S/C18H17NO2S3/c20-24(21,14-7-2-1-3-8-14)19-13-16(18-22-11-6-12-23-18)15-9-4-5-10-17(15)19/h1-5,7-10,13,18H,6,11-12H2 |
| InChIKey | TWCJEEZMMJTFNW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole?
The IUPAC name of 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole (CID 15711202) is 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole.
What is the SMILES notation for 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole?
The canonical SMILES for 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole is O=S(=O)(c1ccccc1)n1cc(C2SCCCS2)c2ccccc21.
What is the InChIKey of 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole?
The InChIKey is TWCJEEZMMJTFNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2S3/c20-24(21,14-7-2-1-3-8-14)19-13-16(18-22-11-6-12-23-18)15-9-4-5-10-17(15)19/h1-5,7-10,13,18H,6,11-12H2.
What are the key properties of 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole?
1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole has a molecular weight of 375.54 g/mol, XLogP of 4.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole is sourced from PubChem (CID 15711202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).