C18H17NO2S3 — CID 15711202
1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole (PubChem CID 15711202) has the molecular formula C18H17NO2S3 and a molecular weight of 375.54 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole.
| Compound Name | 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole |
|---|---|
| PubChem CID | 15711202 |
| Molecular Formula | C18H17NO2S3 |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(1,3-dithian-2-yl)indole |
| SMILES | O=S(=O)(c1ccccc1)n1cc(C2SCCCS2)c2ccccc21 |
| InChI | InChI=1S/C18H17NO2S3/c20-24(21,14-7-2-1-3-8-14)19-13-16(18-22-11-6-12-23-18)15-9-4-5-10-17(15)19/h1-5,7-10,13,18H,6,11-12H2 |
| InChIKey | TWCJEEZMMJTFNW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |