C16H11Br2NO3S — CID 165354789
1-[1-(benzenesulfonyl)indol-3-yl]-2,2-dibromoethanone (PubChem CID 165354789) has the molecular formula C16H11Br2NO3S and a molecular weight of 457.14 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)indol-3-yl]-2,2-dibromoethanone.
| Compound Name | 1-[1-(benzenesulfonyl)indol-3-yl]-2,2-dibromoethanone |
|---|---|
| PubChem CID | 165354789 |
| Molecular Formula | C16H11Br2NO3S |
| Molecular Weight | 457.14 g/mol |
| Exact Mass | 454.88 |
| IUPAC Name | 1-[1-(benzenesulfonyl)indol-3-yl]-2,2-dibromoethanone |
| SMILES | O=C(c1cn(S(=O)(=O)c2ccccc2)c2ccccc12)C(Br)Br |
| InChI | InChI=1S/C16H11Br2NO3S/c17-16(18)15(20)13-10-19(14-9-5-4-8-12(13)14)23(21,22)11-6-2-1-3-7-11/h1-10,16H |
| InChIKey | VDLRAUFNXCTHIU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.14 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|