C23H18N2O5S — CID 174661053
4-[[[1-(benzenesulfonyl)indole-3-carbonyl]amino]methyl]benzoic acid (PubChem CID 174661053) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is 4-[[[1-(benzenesulfonyl)indole-3-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[1-(benzenesulfonyl)indole-3-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 174661053 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 4-[[[1-(benzenesulfonyl)indole-3-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2cn(S(=O)(=O)c3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H18N2O5S/c26-22(24-14-16-10-12-17(13-11-16)23(27)28)20-15-25(21-9-5-4-8-19(20)21)31(29,30)18-6-2-1-3-7-18/h1-13,15H,14H2,(H,24,26)(H,27,28) |
| InChIKey | IRTLDXLMTFRCJA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |