C31H27N3O4S — CID 58975151
N,N-dimethyl-4-[[[4-(3-phenylindol-1-yl)sulfonylbenzoyl]amino]methyl]benzamide (PubChem CID 58975151) has the molecular formula C31H27N3O4S and a molecular weight of 537.64 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[4-(3-phenylindol-1-yl)sulfonylbenzoyl]amino]methyl]benzamide.
| Compound Name | N,N-dimethyl-4-[[[4-(3-phenylindol-1-yl)sulfonylbenzoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 58975151 |
| Molecular Formula | C31H27N3O4S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | N,N-dimethyl-4-[[[4-(3-phenylindol-1-yl)sulfonylbenzoyl]amino]methyl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(CNC(=O)c2ccc(S(=O)(=O)n3cc(-c4ccccc4)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C31H27N3O4S/c1-33(2)31(36)25-14-12-22(13-15-25)20-32-30(35)24-16-18-26(19-17-24)39(37,38)34-21-28(23-8-4-3-5-9-23)27-10-6-7-11-29(27)34/h3-19,21H,20H2,1-2H3,(H,32,35) |
| InChIKey | XYFYDDMELIBPKM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |