C26H22F2N2O3S — CID 58975205
(4,4-difluoropiperidin-1-yl)-[4-(3-phenylindol-1-yl)sulfonylphenyl]methanone (PubChem CID 58975205) has the molecular formula C26H22F2N2O3S and a molecular weight of 480.54 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[4-(3-phenylindol-1-yl)sulfonylphenyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[4-(3-phenylindol-1-yl)sulfonylphenyl]methanone |
|---|---|
| PubChem CID | 58975205 |
| Molecular Formula | C26H22F2N2O3S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[4-(3-phenylindol-1-yl)sulfonylphenyl]methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)n2cc(-c3ccccc3)c3ccccc32)cc1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C26H22F2N2O3S/c27-26(28)14-16-29(17-15-26)25(31)20-10-12-21(13-11-20)34(32,33)30-18-23(19-6-2-1-3-7-19)22-8-4-5-9-24(22)30/h1-13,18H,14-17H2 |
| InChIKey | KTSWOINZHHHPAF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |