C30H25FN4O3S — CID 58975016
[3-[[(6-fluoro-2-pyridinyl)amino]methyl]azetidin-1-yl]-[4-(3-phenylindol-1-yl)sulfonylphenyl]methanone (PubChem CID 58975016) has the molecular formula C30H25FN4O3S and a molecular weight of 540.62 g/mol. Its IUPAC name is [3-[[(6-fluoro-2-pyridinyl)amino]methyl]azetidin-1-yl]-[4-(3-phenylindol-1-yl)sulfonylphenyl]methanone.
| Compound Name | [3-[[(6-fluoro-2-pyridinyl)amino]methyl]azetidin-1-yl]-[4-(3-phenylindol-1-yl)sulfonylphenyl]methanone |
|---|---|
| PubChem CID | 58975016 |
| Molecular Formula | C30H25FN4O3S |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | [3-[[(6-fluoro-2-pyridinyl)amino]methyl]azetidin-1-yl]-[4-(3-phenylindol-1-yl)sulfonylphenyl]methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)n2cc(-c3ccccc3)c3ccccc32)cc1)N1CC(CNc2cccc(F)n2)C1 |
| InChI | InChI=1S/C30H25FN4O3S/c31-28-11-6-12-29(33-28)32-17-21-18-34(19-21)30(36)23-13-15-24(16-14-23)39(37,38)35-20-26(22-7-2-1-3-8-22)25-9-4-5-10-27(25)35/h1-16,20-21H,17-19H2,(H,32,33) |
| InChIKey | UFZTXEYZEFLSTG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|