C31H27N3O3S — CID 58855815
N-[1-(4-methylphenyl)azetidin-3-yl]-4-(3-phenylindol-1-yl)sulfonylbenzamide (PubChem CID 58855815) has the molecular formula C31H27N3O3S and a molecular weight of 521.64 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)azetidin-3-yl]-4-(3-phenylindol-1-yl)sulfonylbenzamide.
| Compound Name | N-[1-(4-methylphenyl)azetidin-3-yl]-4-(3-phenylindol-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 58855815 |
| Molecular Formula | C31H27N3O3S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-[1-(4-methylphenyl)azetidin-3-yl]-4-(3-phenylindol-1-yl)sulfonylbenzamide |
| SMILES | Cc1ccc(N2CC(NC(=O)c3ccc(S(=O)(=O)n4cc(-c5ccccc5)c5ccccc54)cc3)C2)cc1 |
| InChI | InChI=1S/C31H27N3O3S/c1-22-11-15-26(16-12-22)33-19-25(20-33)32-31(35)24-13-17-27(18-14-24)38(36,37)34-21-29(23-7-3-2-4-8-23)28-9-5-6-10-30(28)34/h2-18,21,25H,19-20H2,1H3,(H,32,35) |
| InChIKey | BZWXWVBXYFABOO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|