C26H22N4O3S — CID 58855813
N-(1,2-dihydropyridazin-3-ylmethyl)-4-(3-phenylindol-1-yl)sulfonylbenzamide (PubChem CID 58855813) has the molecular formula C26H22N4O3S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-(1,2-dihydropyridazin-3-ylmethyl)-4-(3-phenylindol-1-yl)sulfonylbenzamide.
| Compound Name | N-(1,2-dihydropyridazin-3-ylmethyl)-4-(3-phenylindol-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 58855813 |
| Molecular Formula | C26H22N4O3S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-(1,2-dihydropyridazin-3-ylmethyl)-4-(3-phenylindol-1-yl)sulfonylbenzamide |
| SMILES | O=C(NCC1=CC=CNN1)c1ccc(S(=O)(=O)n2cc(-c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H22N4O3S/c31-26(27-17-21-9-6-16-28-29-21)20-12-14-22(15-13-20)34(32,33)30-18-24(19-7-2-1-3-8-19)23-10-4-5-11-25(23)30/h1-16,18,28-29H,17H2,(H,27,31) |
| InChIKey | UXESJOOVEJCMOE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |