C23H19FN2O3S — CID 58975171
N-[(4-fluorophenyl)methyl]-4-(3-methylindol-1-yl)sulfonylbenzamide (PubChem CID 58975171) has the molecular formula C23H19FN2O3S and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-(3-methylindol-1-yl)sulfonylbenzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-(3-methylindol-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 58975171 |
| Molecular Formula | C23H19FN2O3S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-(3-methylindol-1-yl)sulfonylbenzamide |
| SMILES | Cc1cn(S(=O)(=O)c2ccc(C(=O)NCc3ccc(F)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H19FN2O3S/c1-16-15-26(22-5-3-2-4-21(16)22)30(28,29)20-12-8-18(9-13-20)23(27)25-14-17-6-10-19(24)11-7-17/h2-13,15H,14H2,1H3,(H,25,27) |
| InChIKey | ZDZKPUOIMWVPIP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |