C22H19FN2O3S — CID 58975118
4-(2,3-dihydroindol-1-ylsulfonyl)-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 58975118) has the molecular formula C22H19FN2O3S and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-ylsulfonyl)-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 4-(2,3-dihydroindol-1-ylsulfonyl)-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58975118 |
| Molecular Formula | C22H19FN2O3S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 4-(2,3-dihydroindol-1-ylsulfonyl)-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C22H19FN2O3S/c23-19-9-5-16(6-10-19)15-24-22(26)18-7-11-20(12-8-18)29(27,28)25-14-13-17-3-1-2-4-21(17)25/h1-12H,13-15H2,(H,24,26) |
| InChIKey | IZAWZSGSLIDKDF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |