C24H19FN2O4S — CID 58975029
4-(3-acetylindol-1-yl)sulfonyl-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 58975029) has the molecular formula C24H19FN2O4S and a molecular weight of 450.49 g/mol. Its IUPAC name is 4-(3-acetylindol-1-yl)sulfonyl-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 4-(3-acetylindol-1-yl)sulfonyl-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58975029 |
| Molecular Formula | C24H19FN2O4S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 4-(3-acetylindol-1-yl)sulfonyl-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | CC(=O)c1cn(S(=O)(=O)c2ccc(C(=O)NCc3ccc(F)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H19FN2O4S/c1-16(28)22-15-27(23-5-3-2-4-21(22)23)32(30,31)20-12-8-18(9-13-20)24(29)26-14-17-6-10-19(25)11-7-17/h2-13,15H,14H2,1H3,(H,26,29) |
| InChIKey | UVYMYFMNUPDGPQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |