C21H21NO2S — CID 134950379
1-(4-methylphenyl)sulfonyl-3-phenyl-4,5,6,7-tetrahydroindole (PubChem CID 134950379) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-phenyl-4,5,6,7-tetrahydroindole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-phenyl-4,5,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 134950379 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-phenyl-4,5,6,7-tetrahydroindole |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccccc3)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C21H21NO2S/c1-16-11-13-18(14-12-16)25(23,24)22-15-20(17-7-3-2-4-8-17)19-9-5-6-10-21(19)22/h2-4,7-8,11-15H,5-6,9-10H2,1H3 |
| InChIKey | PGPUUKJWVAYTNU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |