C27H23NO3S — CID 132509620
1-(4-methylphenyl)sulfonyl-3,6-diphenyl-6,7-dihydro-5H-indol-4-one (PubChem CID 132509620) has the molecular formula C27H23NO3S and a molecular weight of 441.55 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3,6-diphenyl-6,7-dihydro-5H-indol-4-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3,6-diphenyl-6,7-dihydro-5H-indol-4-one |
|---|---|
| PubChem CID | 132509620 |
| Molecular Formula | C27H23NO3S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3,6-diphenyl-6,7-dihydro-5H-indol-4-one |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccccc3)c3c2CC(c2ccccc2)CC3=O)cc1 |
| InChI | InChI=1S/C27H23NO3S/c1-19-12-14-23(15-13-19)32(30,31)28-18-24(21-10-6-3-7-11-21)27-25(28)16-22(17-26(27)29)20-8-4-2-5-9-20/h2-15,18,22H,16-17H2,1H3 |
| InChIKey | IIVPTZJRPPCGKV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |