C24H23NO2S — CID 102402863
1-(4-methylphenyl)sulfonyl-3,4-diphenyl-3,6-dihydro-2H-pyridine (PubChem CID 102402863) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3,4-diphenyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3,4-diphenyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 102402863 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3,4-diphenyl-3,6-dihydro-2H-pyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C(c3ccccc3)C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H23NO2S/c1-19-12-14-22(15-13-19)28(26,27)25-17-16-23(20-8-4-2-5-9-20)24(18-25)21-10-6-3-7-11-21/h2-16,24H,17-18H2,1H3 |
| InChIKey | JCYAZJXPDJKCPC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |