C31H27NO3S — CID 155907297
3-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-2,3-dihydropyridin-6-one (PubChem CID 155907297) has the molecular formula C31H27NO3S and a molecular weight of 493.63 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-2,3-dihydropyridin-6-one.
| Compound Name | 3-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 155907297 |
| Molecular Formula | C31H27NO3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 3-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-2,3-dihydropyridin-6-one |
| SMILES | Cc1ccc(C2CN(S(=O)(=O)c3ccc(C)cc3)C(=O)C(c3ccccc3)=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H27NO3S/c1-22-13-17-24(18-14-22)28-21-32(36(34,35)27-19-15-23(2)16-20-27)31(33)30(26-11-7-4-8-12-26)29(28)25-9-5-3-6-10-25/h3-20,28H,21H2,1-2H3 |
| InChIKey | CRISHRXKOXSXCR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|