C30H23F2NO3S — CID 155907206
4,5-bis(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3-phenyl-2,3-dihydropyridin-6-one (PubChem CID 155907206) has the molecular formula C30H23F2NO3S and a molecular weight of 515.58 g/mol. Its IUPAC name is 4,5-bis(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3-phenyl-2,3-dihydropyridin-6-one.
| Compound Name | 4,5-bis(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3-phenyl-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 155907206 |
| Molecular Formula | C30H23F2NO3S |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 4,5-bis(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3-phenyl-2,3-dihydropyridin-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3ccccc3)C(c3ccccc3F)=C(c3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C30H23F2NO3S/c1-20-15-17-22(18-16-20)37(35,36)33-19-25(21-9-3-2-4-10-21)28(23-11-5-7-13-26(23)31)29(30(33)34)24-12-6-8-14-27(24)32/h2-18,25H,19H2,1H3 |
| InChIKey | GYMCZPUFYAEGPL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|