C22H23NO5S — CID 102109920
(2S)-2-[(R)-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-hydroxymethyl]cyclohexan-1-one (PubChem CID 102109920) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is (2S)-2-[(R)-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-hydroxymethyl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(R)-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-hydroxymethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102109920 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (2S)-2-[(R)-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-hydroxymethyl]cyclohexan-1-one |
| SMILES | COc1ccc2c(c1)c([C@H](O)[C@@H]1CCCCC1=O)cn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO5S/c1-28-15-11-12-20-18(13-15)19(22(25)17-9-5-6-10-21(17)24)14-23(20)29(26,27)16-7-3-2-4-8-16/h2-4,7-8,11-14,17,22,25H,5-6,9-10H2,1H3/t17-,22-/m1/s1 |
| InChIKey | HSZCWGZYBQUUIA-VGOFRKELSA-N |
| XLogP | 3.68 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |