C40H42N4O10S2 — CID 118703867
bis[2-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-1-(dimethylamino)ethyl] oxalate (PubChem CID 118703867) has the molecular formula C40H42N4O10S2 and a molecular weight of 802.93 g/mol. Its IUPAC name is bis[2-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-1-(dimethylamino)ethyl] oxalate.
| Compound Name | bis[2-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-1-(dimethylamino)ethyl] oxalate |
|---|---|
| PubChem CID | 118703867 |
| Molecular Formula | C40H42N4O10S2 |
| Molecular Weight | 802.93 g/mol |
| Exact Mass | 802.23 |
| IUPAC Name | bis[2-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-1-(dimethylamino)ethyl] oxalate |
| SMILES | COc1ccc2c(c1)c(CC(OC(=O)C(=O)OC(Cc1cn(S(=O)(=O)c3ccccc3)c3ccc(OC)cc13)N(C)C)N(C)C)cn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C40H42N4O10S2/c1-41(2)37(21-27-25-43(35-19-17-29(51-5)23-33(27)35)55(47,48)31-13-9-7-10-14-31)53-39(45)40(46)54-38(42(3)4)22-28-26-44(36-20-18-30(52-6)24-34(28)36)56(49,50)32-15-11-8-12-16-32/h7-20,23-26,37-38H,21-22H2,1-6H3 |
| InChIKey | GXLRWFZXUPHGSG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 155.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.93 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|