C19H19NO5S — CID 18449977
3-[1-(benzenesulfonyl)-5-ethoxyindol-3-yl]propanoic acid (PubChem CID 18449977) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is 3-[1-(benzenesulfonyl)-5-ethoxyindol-3-yl]propanoic acid.
| Compound Name | 3-[1-(benzenesulfonyl)-5-ethoxyindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 18449977 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 3-[1-(benzenesulfonyl)-5-ethoxyindol-3-yl]propanoic acid |
| SMILES | CCOc1ccc2c(c1)c(CCC(=O)O)cn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO5S/c1-2-25-15-9-10-18-17(12-15)14(8-11-19(21)22)13-20(18)26(23,24)16-6-4-3-5-7-16/h3-7,9-10,12-13H,2,8,11H2,1H3,(H,21,22) |
| InChIKey | IJSROHRUJULMQJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |