C20H21NO6S — CID 71213005
3-[1-(4-ethoxyphenyl)sulfonyl-5-methoxyindol-3-yl]propanoic acid (PubChem CID 71213005) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is 3-[1-(4-ethoxyphenyl)sulfonyl-5-methoxyindol-3-yl]propanoic acid.
| Compound Name | 3-[1-(4-ethoxyphenyl)sulfonyl-5-methoxyindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 71213005 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-[1-(4-ethoxyphenyl)sulfonyl-5-methoxyindol-3-yl]propanoic acid |
| SMILES | CCOc1ccc(S(=O)(=O)n2cc(CCC(=O)O)c3cc(OC)ccc32)cc1 |
| InChI | InChI=1S/C20H21NO6S/c1-3-27-15-5-8-17(9-6-15)28(24,25)21-13-14(4-11-20(22)23)18-12-16(26-2)7-10-19(18)21/h5-10,12-13H,3-4,11H2,1-2H3,(H,22,23) |
| InChIKey | ABIMGUFOLPCBPP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |