C20H21NO5S — CID 142993192
3-[1-(3,4-dimethylphenyl)sulfonyl-5-methoxyindol-3-yl]propanoic acid (PubChem CID 142993192) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-[1-(3,4-dimethylphenyl)sulfonyl-5-methoxyindol-3-yl]propanoic acid.
| Compound Name | 3-[1-(3,4-dimethylphenyl)sulfonyl-5-methoxyindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 142993192 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[1-(3,4-dimethylphenyl)sulfonyl-5-methoxyindol-3-yl]propanoic acid |
| SMILES | COc1ccc2c(c1)c(CCC(=O)O)cn2S(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H21NO5S/c1-13-4-7-17(10-14(13)2)27(24,25)21-12-15(5-9-20(22)23)18-11-16(26-3)6-8-19(18)21/h4,6-8,10-12H,5,9H2,1-3H3,(H,22,23) |
| InChIKey | NVWHQVPCXPJLEG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |