C22H19NO5S2 — CID 58838255
3-[1-(4-methoxyphenyl)sulfonyl-5-thiophen-3-ylindol-3-yl]propanoic acid (PubChem CID 58838255) has the molecular formula C22H19NO5S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-[1-(4-methoxyphenyl)sulfonyl-5-thiophen-3-ylindol-3-yl]propanoic acid.
| Compound Name | 3-[1-(4-methoxyphenyl)sulfonyl-5-thiophen-3-ylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58838255 |
| Molecular Formula | C22H19NO5S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 3-[1-(4-methoxyphenyl)sulfonyl-5-thiophen-3-ylindol-3-yl]propanoic acid |
| SMILES | COc1ccc(S(=O)(=O)n2cc(CCC(=O)O)c3cc(-c4ccsc4)ccc32)cc1 |
| InChI | InChI=1S/C22H19NO5S2/c1-28-18-4-6-19(7-5-18)30(26,27)23-13-16(3-9-22(24)25)20-12-15(2-8-21(20)23)17-10-11-29-14-17/h2,4-8,10-14H,3,9H2,1H3,(H,24,25) |
| InChIKey | SGHGOBXBESTLHO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |