C29H24N2O6S — CID 58837731
3-[1-[4-(4-methoxyphenoxy)phenyl]sulfonyl-5-pyridin-3-ylindol-3-yl]propanoic acid (PubChem CID 58837731) has the molecular formula C29H24N2O6S and a molecular weight of 528.59 g/mol. Its IUPAC name is 3-[1-[4-(4-methoxyphenoxy)phenyl]sulfonyl-5-pyridin-3-ylindol-3-yl]propanoic acid.
| Compound Name | 3-[1-[4-(4-methoxyphenoxy)phenyl]sulfonyl-5-pyridin-3-ylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58837731 |
| Molecular Formula | C29H24N2O6S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 3-[1-[4-(4-methoxyphenoxy)phenyl]sulfonyl-5-pyridin-3-ylindol-3-yl]propanoic acid |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)n3cc(CCC(=O)O)c4cc(-c5cccnc5)ccc43)cc2)cc1 |
| InChI | InChI=1S/C29H24N2O6S/c1-36-23-6-8-24(9-7-23)37-25-10-12-26(13-11-25)38(34,35)31-19-22(5-15-29(32)33)27-17-20(4-14-28(27)31)21-3-2-16-30-18-21/h2-4,6-14,16-19H,5,15H2,1H3,(H,32,33) |
| InChIKey | DVICTKOREVZSTE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |