C20H21NO7S — CID 18450023
3-[5,6-dimethoxy-1-(4-methoxyphenyl)sulfonylindol-3-yl]propanoic acid (PubChem CID 18450023) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is 3-[5,6-dimethoxy-1-(4-methoxyphenyl)sulfonylindol-3-yl]propanoic acid.
| Compound Name | 3-[5,6-dimethoxy-1-(4-methoxyphenyl)sulfonylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 18450023 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 3-[5,6-dimethoxy-1-(4-methoxyphenyl)sulfonylindol-3-yl]propanoic acid |
| SMILES | COc1ccc(S(=O)(=O)n2cc(CCC(=O)O)c3cc(OC)c(OC)cc32)cc1 |
| InChI | InChI=1S/C20H21NO7S/c1-26-14-5-7-15(8-6-14)29(24,25)21-12-13(4-9-20(22)23)16-10-18(27-2)19(28-3)11-17(16)21/h5-8,10-12H,4,9H2,1-3H3,(H,22,23) |
| InChIKey | AIFDYNNBGPAUCB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |