C19H16F3NO8S2 — CID 89376158
3-[5-methoxy-1-[4-(trifluoromethylsulfonyloxy)phenyl]sulfonylindol-3-yl]propanoic acid (PubChem CID 89376158) has the molecular formula C19H16F3NO8S2 and a molecular weight of 507.46 g/mol. Its IUPAC name is 3-[5-methoxy-1-[4-(trifluoromethylsulfonyloxy)phenyl]sulfonylindol-3-yl]propanoic acid.
| Compound Name | 3-[5-methoxy-1-[4-(trifluoromethylsulfonyloxy)phenyl]sulfonylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 89376158 |
| Molecular Formula | C19H16F3NO8S2 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | 3-[5-methoxy-1-[4-(trifluoromethylsulfonyloxy)phenyl]sulfonylindol-3-yl]propanoic acid |
| SMILES | COc1ccc2c(c1)c(CCC(=O)O)cn2S(=O)(=O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3NO8S2/c1-30-14-5-8-17-16(10-14)12(2-9-18(24)25)11-23(17)32(26,27)15-6-3-13(4-7-15)31-33(28,29)19(20,21)22/h3-8,10-11H,2,9H2,1H3,(H,24,25) |
| InChIKey | WNHAIZSFHIMJDL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|