C19H18ClNO5S — CID 18450017
methyl 3-[1-(4-chlorophenyl)sulfonyl-5-methoxyindol-3-yl]propanoate (PubChem CID 18450017) has the molecular formula C19H18ClNO5S and a molecular weight of 407.88 g/mol. Its IUPAC name is methyl 3-[1-(4-chlorophenyl)sulfonyl-5-methoxyindol-3-yl]propanoate.
| Compound Name | methyl 3-[1-(4-chlorophenyl)sulfonyl-5-methoxyindol-3-yl]propanoate |
|---|---|
| PubChem CID | 18450017 |
| Molecular Formula | C19H18ClNO5S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | methyl 3-[1-(4-chlorophenyl)sulfonyl-5-methoxyindol-3-yl]propanoate |
| SMILES | COC(=O)CCc1cn(S(=O)(=O)c2ccc(Cl)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C19H18ClNO5S/c1-25-15-6-9-18-17(11-15)13(3-10-19(22)26-2)12-21(18)27(23,24)16-7-4-14(20)5-8-16/h4-9,11-12H,3,10H2,1-2H3 |
| InChIKey | UBLACLWDPMBIPU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |