C20H20INO5S — CID 89345094
methyl 3-[1-[4-(iodomethyl)phenyl]sulfonyl-5-methoxyindol-3-yl]propanoate (PubChem CID 89345094) has the molecular formula C20H20INO5S and a molecular weight of 513.35 g/mol. Its IUPAC name is methyl 3-[1-[4-(iodomethyl)phenyl]sulfonyl-5-methoxyindol-3-yl]propanoate.
| Compound Name | methyl 3-[1-[4-(iodomethyl)phenyl]sulfonyl-5-methoxyindol-3-yl]propanoate |
|---|---|
| PubChem CID | 89345094 |
| Molecular Formula | C20H20INO5S |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | methyl 3-[1-[4-(iodomethyl)phenyl]sulfonyl-5-methoxyindol-3-yl]propanoate |
| SMILES | COC(=O)CCc1cn(S(=O)(=O)c2ccc(CI)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C20H20INO5S/c1-26-16-6-9-19-18(11-16)15(5-10-20(23)27-2)13-22(19)28(24,25)17-7-3-14(12-21)4-8-17/h3-4,6-9,11,13H,5,10,12H2,1-2H3 |
| InChIKey | PKDPBEYNHHOLCQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|