C19H21NO5S — CID 58843122
3-[1-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]-5-methoxyindol-3-yl]propanoic acid (PubChem CID 58843122) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 3-[1-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]-5-methoxyindol-3-yl]propanoic acid.
| Compound Name | 3-[1-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]-5-methoxyindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58843122 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 3-[1-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]-5-methoxyindol-3-yl]propanoic acid |
| SMILES | COc1ccc2c(c1)c(CCC(=O)O)cn2S(O)(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-13-3-7-16(8-4-13)26(23,24)20-12-14(5-10-19(21)22)17-11-15(25-2)6-9-18(17)20/h3-4,6-9,11-12,23-24H,5,10H2,1-2H3,(H,21,22) |
| InChIKey | NNUJILHAKGAQQU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |