C17H16ClNO5S2 — CID 58837662
3-[1-(5-chlorothiophen-2-yl)sulfonyl-5-ethoxyindol-3-yl]propanoic acid (PubChem CID 58837662) has the molecular formula C17H16ClNO5S2 and a molecular weight of 413.90 g/mol. Its IUPAC name is 3-[1-(5-chlorothiophen-2-yl)sulfonyl-5-ethoxyindol-3-yl]propanoic acid.
| Compound Name | 3-[1-(5-chlorothiophen-2-yl)sulfonyl-5-ethoxyindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58837662 |
| Molecular Formula | C17H16ClNO5S2 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 3-[1-(5-chlorothiophen-2-yl)sulfonyl-5-ethoxyindol-3-yl]propanoic acid |
| SMILES | CCOc1ccc2c(c1)c(CCC(=O)O)cn2S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H16ClNO5S2/c1-2-24-12-4-5-14-13(9-12)11(3-7-16(20)21)10-19(14)26(22,23)17-8-6-15(18)25-17/h4-6,8-10H,2-3,7H2,1H3,(H,20,21) |
| InChIKey | LYGAOOTVTYTPTG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |