C23H20ClNO5S2 — CID 58838249
3-[5-chloro-1-[5-(4-ethoxyphenyl)thiophen-2-yl]sulfonylindol-3-yl]propanoic acid (PubChem CID 58838249) has the molecular formula C23H20ClNO5S2 and a molecular weight of 490.00 g/mol. Its IUPAC name is 3-[5-chloro-1-[5-(4-ethoxyphenyl)thiophen-2-yl]sulfonylindol-3-yl]propanoic acid.
| Compound Name | 3-[5-chloro-1-[5-(4-ethoxyphenyl)thiophen-2-yl]sulfonylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58838249 |
| Molecular Formula | C23H20ClNO5S2 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | 3-[5-chloro-1-[5-(4-ethoxyphenyl)thiophen-2-yl]sulfonylindol-3-yl]propanoic acid |
| SMILES | CCOc1ccc(-c2ccc(S(=O)(=O)n3cc(CCC(=O)O)c4cc(Cl)ccc43)s2)cc1 |
| InChI | InChI=1S/C23H20ClNO5S2/c1-2-30-18-7-3-15(4-8-18)21-10-12-23(31-21)32(28,29)25-14-16(5-11-22(26)27)19-13-17(24)6-9-20(19)25/h3-4,6-10,12-14H,2,5,11H2,1H3,(H,26,27) |
| InChIKey | OBFIGSPNAKGZIR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |