C21H19N3O5S2 — CID 58838128
3-[5-ethoxy-1-(5-pyrimidin-5-ylthiophen-2-yl)sulfonylindol-3-yl]propanoic acid (PubChem CID 58838128) has the molecular formula C21H19N3O5S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-[5-ethoxy-1-(5-pyrimidin-5-ylthiophen-2-yl)sulfonylindol-3-yl]propanoic acid.
| Compound Name | 3-[5-ethoxy-1-(5-pyrimidin-5-ylthiophen-2-yl)sulfonylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58838128 |
| Molecular Formula | C21H19N3O5S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 3-[5-ethoxy-1-(5-pyrimidin-5-ylthiophen-2-yl)sulfonylindol-3-yl]propanoic acid |
| SMILES | CCOc1ccc2c(c1)c(CCC(=O)O)cn2S(=O)(=O)c1ccc(-c2cncnc2)s1 |
| InChI | InChI=1S/C21H19N3O5S2/c1-2-29-16-4-5-18-17(9-16)14(3-7-20(25)26)12-24(18)31(27,28)21-8-6-19(30-21)15-10-22-13-23-11-15/h4-6,8-13H,2-3,7H2,1H3,(H,25,26) |
| InChIKey | FIRBKEFAIDKFBL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |