C22H16F3NO5S2 — CID 58837725
3-[1-[5-[3-(trifluoromethoxy)phenyl]thiophen-2-yl]sulfonylindol-3-yl]propanoic acid (PubChem CID 58837725) has the molecular formula C22H16F3NO5S2 and a molecular weight of 495.50 g/mol. Its IUPAC name is 3-[1-[5-[3-(trifluoromethoxy)phenyl]thiophen-2-yl]sulfonylindol-3-yl]propanoic acid.
| Compound Name | 3-[1-[5-[3-(trifluoromethoxy)phenyl]thiophen-2-yl]sulfonylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58837725 |
| Molecular Formula | C22H16F3NO5S2 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | 3-[1-[5-[3-(trifluoromethoxy)phenyl]thiophen-2-yl]sulfonylindol-3-yl]propanoic acid |
| SMILES | O=C(O)CCc1cn(S(=O)(=O)c2ccc(-c3cccc(OC(F)(F)F)c3)s2)c2ccccc12 |
| InChI | InChI=1S/C22H16F3NO5S2/c23-22(24,25)31-16-5-3-4-14(12-16)19-9-11-21(32-19)33(29,30)26-13-15(8-10-20(27)28)17-6-1-2-7-18(17)26/h1-7,9,11-13H,8,10H2,(H,27,28) |
| InChIKey | IZOATMXYAURNTR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |